C20H22N2O7S2 — CID 1448342
N-(6-acetyl-1,3-benzodioxol-5-yl)-4-piperidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 1448342) has the molecular formula C20H22N2O7S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-4-piperidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-4-piperidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 1448342 |
| Molecular Formula | C20H22N2O7S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-4-piperidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | CC(=O)c1cc2c(cc1NS(=O)(=O)c1ccc(S(=O)(=O)N3CCCCC3)cc1)OCO2 |
| InChI | InChI=1S/C20H22N2O7S2/c1-14(23)17-11-19-20(29-13-28-19)12-18(17)21-30(24,25)15-5-7-16(8-6-15)31(26,27)22-9-3-2-4-10-22/h5-8,11-12,21H,2-4,9-10,13H2,1H3 |
| InChIKey | RAVLYTZGLRLFFT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |