C15H12BrNO5S — CID 1448349
N-(6-acetyl-1,3-benzodioxol-5-yl)-4-bromobenzenesulfonamide (PubChem CID 1448349) has the molecular formula C15H12BrNO5S and a molecular weight of 398.23 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-4-bromobenzenesulfonamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-4-bromobenzenesulfonamide |
|---|---|
| PubChem CID | 1448349 |
| Molecular Formula | C15H12BrNO5S |
| Molecular Weight | 398.23 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-4-bromobenzenesulfonamide |
| SMILES | CC(=O)c1cc2c(cc1NS(=O)(=O)c1ccc(Br)cc1)OCO2 |
| InChI | InChI=1S/C15H12BrNO5S/c1-9(18)12-6-14-15(22-8-21-14)7-13(12)17-23(19,20)11-4-2-10(16)3-5-11/h2-7,17H,8H2,1H3 |
| InChIKey | HBDGTASSZYGCCX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |