C22H18BrN2O5S+ — CID 5049022
[[(6-acetyl-1,3-benzodioxol-5-yl)amino]-phenylmethylidene]-(4-bromophenyl)sulfonylazanium (PubChem CID 5049022) has the molecular formula C22H18BrN2O5S+ and a molecular weight of 502.37 g/mol. Its IUPAC name is [[(6-acetyl-1,3-benzodioxol-5-yl)amino]-phenylmethylidene]-(4-bromophenyl)sulfonylazanium.
| Compound Name | [[(6-acetyl-1,3-benzodioxol-5-yl)amino]-phenylmethylidene]-(4-bromophenyl)sulfonylazanium |
|---|---|
| PubChem CID | 5049022 |
| Molecular Formula | C22H18BrN2O5S+ |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 501.01 |
| IUPAC Name | [[(6-acetyl-1,3-benzodioxol-5-yl)amino]-phenylmethylidene]-(4-bromophenyl)sulfonylazanium |
| SMILES | CC(=O)c1cc2c(cc1NC(=[NH+]S(=O)(=O)c1ccc(Br)cc1)c1ccccc1)OCO2 |
| InChI | InChI=1S/C22H17BrN2O5S/c1-14(26)18-11-20-21(30-13-29-20)12-19(18)24-22(15-5-3-2-4-6-15)25-31(27,28)17-9-7-16(23)8-10-17/h2-12H,13H2,1H3,(H,24,25)/p+1 |
| InChIKey | TWTOSHQUQJNBIV-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|