C22H17FN2O5S — CID 5049025
N-(6-acetyl-1,3-benzodioxol-5-yl)-N'-(4-fluorophenyl)sulfonylbenzenecarboximidamide (PubChem CID 5049025) has the molecular formula C22H17FN2O5S and a molecular weight of 440.45 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-N'-(4-fluorophenyl)sulfonylbenzenecarboximidamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-N'-(4-fluorophenyl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 5049025 |
| Molecular Formula | C22H17FN2O5S |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-N'-(4-fluorophenyl)sulfonylbenzenecarboximidamide |
| SMILES | CC(=O)c1cc2c(cc1NC(=NS(=O)(=O)c1ccc(F)cc1)c1ccccc1)OCO2 |
| InChI | InChI=1S/C22H17FN2O5S/c1-14(26)18-11-20-21(30-13-29-20)12-19(18)24-22(15-5-3-2-4-6-15)25-31(27,28)17-9-7-16(23)8-10-17/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | QLXVYMXPXAGWPY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|