C18H19NO5S — CID 3583124
N-(6-acetyl-1,3-benzodioxol-5-yl)-4-propan-2-ylbenzenesulfonamide (PubChem CID 3583124) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is N-(6-acetyl-1,3-benzodioxol-5-yl)-4-propan-2-ylbenzenesulfonamide.
| Compound Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-4-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 3583124 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-(6-acetyl-1,3-benzodioxol-5-yl)-4-propan-2-ylbenzenesulfonamide |
| SMILES | CC(=O)c1cc2c(cc1NS(=O)(=O)c1ccc(C(C)C)cc1)OCO2 |
| InChI | InChI=1S/C18H19NO5S/c1-11(2)13-4-6-14(7-5-13)25(21,22)19-16-9-18-17(23-10-24-18)8-15(16)12(3)20/h4-9,11,19H,10H2,1-3H3 |
| InChIKey | PZILXWQETJDRND-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |