C16H16NO4S- — CID 7574221
2-[(4-propan-2-ylphenyl)sulfonylamino]benzoate (PubChem CID 7574221) has the molecular formula C16H16NO4S- and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-[(4-propan-2-ylphenyl)sulfonylamino]benzoate.
| Compound Name | 2-[(4-propan-2-ylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 7574221 |
| Molecular Formula | C16H16NO4S- |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[(4-propan-2-ylphenyl)sulfonylamino]benzoate |
| SMILES | CC(C)c1ccc(S(=O)(=O)Nc2ccccc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H17NO4S/c1-11(2)12-7-9-13(10-8-12)22(20,21)17-15-6-4-3-5-14(15)16(18)19/h3-11,17H,1-2H3,(H,18,19)/p-1 |
| InChIKey | LEPVVVNGFNERGV-UHFFFAOYSA-M |
| XLogP | 1.97 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |