C25H22N2O3S — CID 2219459
2-(naphthalen-2-ylsulfonylamino)-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 2219459) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-(naphthalen-2-ylsulfonylamino)-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 2-(naphthalen-2-ylsulfonylamino)-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 2219459 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-(naphthalen-2-ylsulfonylamino)-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1NS(=O)(=O)c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O3S/c1-18(19-9-3-2-4-10-19)26-25(28)23-13-7-8-14-24(23)27-31(29,30)22-16-15-20-11-5-6-12-21(20)17-22/h2-18,27H,1H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | CESWVECTBLSEFQ-GOSISDBHSA-N |
| XLogP | 5.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |