C24H20N2O5S — CID 30713520
2-[(2-oxochromen-6-yl)sulfonylamino]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 30713520) has the molecular formula C24H20N2O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is 2-[(2-oxochromen-6-yl)sulfonylamino]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 2-[(2-oxochromen-6-yl)sulfonylamino]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 30713520 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-[(2-oxochromen-6-yl)sulfonylamino]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1NS(=O)(=O)c1ccc2oc(=O)ccc2c1)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O5S/c1-16(17-7-3-2-4-8-17)25-24(28)20-9-5-6-10-21(20)26-32(29,30)19-12-13-22-18(15-19)11-14-23(27)31-22/h2-16,26H,1H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | PHUVGLLRKLXJMZ-INIZCTEOSA-N |
| XLogP | 4.08 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|