C17H14N2O5S — CID 134040442
N-methyl-3-[(2-oxochromen-6-yl)sulfonylamino]benzamide (PubChem CID 134040442) has the molecular formula C17H14N2O5S and a molecular weight of 358.38 g/mol. Its IUPAC name is N-methyl-3-[(2-oxochromen-6-yl)sulfonylamino]benzamide.
| Compound Name | N-methyl-3-[(2-oxochromen-6-yl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 134040442 |
| Molecular Formula | C17H14N2O5S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-methyl-3-[(2-oxochromen-6-yl)sulfonylamino]benzamide |
| SMILES | CNC(=O)c1cccc(NS(=O)(=O)c2ccc3oc(=O)ccc3c2)c1 |
| InChI | InChI=1S/C17H14N2O5S/c1-18-17(21)12-3-2-4-13(9-12)19-25(22,23)14-6-7-15-11(10-14)5-8-16(20)24-15/h2-10,19H,1H3,(H,18,21) |
| InChIKey | KKALQYWDTNVFRA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|