C19H16N2O5S — CID 134040472
N-[4-[(2-oxochromen-6-yl)sulfonylamino]phenyl]cyclopropanecarboxamide (PubChem CID 134040472) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is N-[4-[(2-oxochromen-6-yl)sulfonylamino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[(2-oxochromen-6-yl)sulfonylamino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 134040472 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[4-[(2-oxochromen-6-yl)sulfonylamino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)c2ccc3oc(=O)ccc3c2)cc1)C1CC1 |
| InChI | InChI=1S/C19H16N2O5S/c22-18-10-3-13-11-16(8-9-17(13)26-18)27(24,25)21-15-6-4-14(5-7-15)20-19(23)12-1-2-12/h3-12,21H,1-2H2,(H,20,23) |
| InChIKey | OTKXBSYJWZMEEH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|