C14H16N2O4S — CID 43603317
2-oxo-N-piperidin-4-ylchromene-6-sulfonamide (PubChem CID 43603317) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-oxo-N-piperidin-4-ylchromene-6-sulfonamide.
| Compound Name | 2-oxo-N-piperidin-4-ylchromene-6-sulfonamide |
|---|---|
| PubChem CID | 43603317 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-oxo-N-piperidin-4-ylchromene-6-sulfonamide |
| SMILES | O=c1ccc2cc(S(=O)(=O)NC3CCNCC3)ccc2o1 |
| InChI | InChI=1S/C14H16N2O4S/c17-14-4-1-10-9-12(2-3-13(10)20-14)21(18,19)16-11-5-7-15-8-6-11/h1-4,9,11,15-16H,5-8H2 |
| InChIKey | KEQWDZBEPPVONN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|