C12H16N2O4S — CID 28811020
N-piperidin-4-yl-1,3-benzodioxole-5-sulfonamide (PubChem CID 28811020) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is N-piperidin-4-yl-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-piperidin-4-yl-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 28811020 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-piperidin-4-yl-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(NC1CCNCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H16N2O4S/c15-19(16,14-9-3-5-13-6-4-9)10-1-2-11-12(7-10)18-8-17-11/h1-2,7,9,13-14H,3-6,8H2 |
| InChIKey | HDVWZVBECFBDAF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |