C12H15NO4S — CID 82305550
4-(1,3-benzodioxol-5-ylsulfonyl)piperidine (PubChem CID 82305550) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylsulfonyl)piperidine.
| Compound Name | 4-(1,3-benzodioxol-5-ylsulfonyl)piperidine |
|---|---|
| PubChem CID | 82305550 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylsulfonyl)piperidine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCO2)C1CCNCC1 |
| InChI | InChI=1S/C12H15NO4S/c14-18(15,9-3-5-13-6-4-9)10-1-2-11-12(7-10)17-8-16-11/h1-2,7,9,13H,3-6,8H2 |
| InChIKey | DFYQKTNDBFKEFE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |