C16H15NO5S — CID 110751552
N-(3,4-dihydro-2H-chromen-3-yl)-1,3-benzodioxole-5-sulfonamide (PubChem CID 110751552) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-3-yl)-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-3-yl)-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 110751552 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-3-yl)-1,3-benzodioxole-5-sulfonamide |
| SMILES | O=S(=O)(NC1COc2ccccc2C1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15NO5S/c18-23(19,13-5-6-15-16(8-13)22-10-21-15)17-12-7-11-3-1-2-4-14(11)20-9-12/h1-6,8,12,17H,7,9-10H2 |
| InChIKey | DJIKDEUCGYRWKP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |