C18H23ClN2O5S — CID 172912664
N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2-oxochromene-6-sulfonamide;hydrochloride (PubChem CID 172912664) has the molecular formula C18H23ClN2O5S and a molecular weight of 414.91 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2-oxochromene-6-sulfonamide;hydrochloride.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2-oxochromene-6-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 172912664 |
| Molecular Formula | C18H23ClN2O5S |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2-oxochromene-6-sulfonamide;hydrochloride |
| SMILES | CO[C@H]1C[C@@H]2CNC[C@@H]2C[C@@H]1NS(=O)(=O)c1ccc2oc(=O)ccc2c1.Cl |
| InChI | InChI=1S/C18H22N2O5S.ClH/c1-24-17-8-13-10-19-9-12(13)7-15(17)20-26(22,23)14-3-4-16-11(6-14)2-5-18(21)25-16;/h2-6,12-13,15,17,19-20H,7-10H2,1H3;1H/t12-,13+,15-,17-;/m0./s1 |
| InChIKey | MEGJMLPEOLQJCJ-YYMCOREQSA-N |
| XLogP | 1.51 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|