C14H24ClN3O4S — CID 172910217
N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide;hydrochloride (PubChem CID 172910217) has the molecular formula C14H24ClN3O4S and a molecular weight of 365.88 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide;hydrochloride.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 172910217 |
| Molecular Formula | C14H24ClN3O4S |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide;hydrochloride |
| SMILES | CO[C@H]1C[C@@H]2CNC[C@@H]2C[C@@H]1NS(=O)(=O)c1c(C)noc1C.Cl |
| InChI | InChI=1S/C14H23N3O4S.ClH/c1-8-14(9(2)21-16-8)22(18,19)17-12-4-10-6-15-7-11(10)5-13(12)20-3;/h10-13,15,17H,4-7H2,1-3H3;1H/t10-,11+,12-,13-;/m0./s1 |
| InChIKey | LUTFHWMZTKDKSI-BYVSKJIISA-N |
| XLogP | 1.00 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |