C15H17ClN2O3 — CID 119300608
N-(2-oxochromen-6-yl)piperidine-3-carboxamide;hydrochloride (PubChem CID 119300608) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is N-(2-oxochromen-6-yl)piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-oxochromen-6-yl)piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119300608 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-(2-oxochromen-6-yl)piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc2oc(=O)ccc2c1)C1CCCNC1 |
| InChI | InChI=1S/C15H16N2O3.ClH/c18-14-6-3-10-8-12(4-5-13(10)20-14)17-15(19)11-2-1-7-16-9-11;/h3-6,8,11,16H,1-2,7,9H2,(H,17,19);1H |
| InChIKey | OYLJLSBIAJPGIM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|