C14H14N2O4 — CID 119743887
N-(2-oxochromen-6-yl)morpholine-2-carboxamide (PubChem CID 119743887) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is N-(2-oxochromen-6-yl)morpholine-2-carboxamide.
| Compound Name | N-(2-oxochromen-6-yl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119743887 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-(2-oxochromen-6-yl)morpholine-2-carboxamide |
| SMILES | O=C(Nc1ccc2oc(=O)ccc2c1)C1CNCCO1 |
| InChI | InChI=1S/C14H14N2O4/c17-13-4-1-9-7-10(2-3-11(9)20-13)16-14(18)12-8-15-5-6-19-12/h1-4,7,12,15H,5-6,8H2,(H,16,18) |
| InChIKey | HIZOILGUZSBSGV-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|