About N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide
N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide (PubChem CID 119788439) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide.
Molecular Properties
| Compound Name | N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide |
| PubChem CID | 119788439 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide |
| SMILES | O=C1CCc2ccc(NC(=O)C3CNCCO3)cc2N1 |
| InChI | InChI=1S/C14H17N3O3/c18-13-4-2-9-1-3-10(7-11(9)17-13)16-14(19)12-8-15-5-6-20-12/h1,3,7,12,15H,2,4-6,8H2,(H,16,19)(H,17,18) |
| InChIKey | BKILTBVPWASHOX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide?
The IUPAC name of N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide (CID 119788439) is N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide.
What is the SMILES notation for N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide?
The canonical SMILES for N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide is O=C1CCc2ccc(NC(=O)C3CNCCO3)cc2N1.
What is the InChIKey of N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide?
The InChIKey is BKILTBVPWASHOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3/c18-13-4-2-9-1-3-10(7-11(9)17-13)16-14(19)12-8-15-5-6-20-12/h1,3,7,12,15H,2,4-6,8H2,(H,16,19)(H,17,18).
What are the key properties of N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide?
N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide has a molecular weight of 275.31 g/mol, XLogP of 0.50, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxo-3,4-dihydro-1H-quinolin-7-yl)morpholine-2-carboxamide is sourced from PubChem (CID 119788439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).