C16H14BrNO3 — CID 146464701
6-bromo-N-(2,3-dimethylphenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 146464701) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is 6-bromo-N-(2,3-dimethylphenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 6-bromo-N-(2,3-dimethylphenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 146464701 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 6-bromo-N-(2,3-dimethylphenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc3c(cc2Br)OCO3)c1C |
| InChI | InChI=1S/C16H14BrNO3/c1-9-4-3-5-13(10(9)2)18-16(19)11-6-14-15(7-12(11)17)21-8-20-14/h3-7H,8H2,1-2H3,(H,18,19) |
| InChIKey | ZGGBBNAQBXADHP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |