C18H17BrN6O3 — CID 168604887
2-[2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-3-oxo-1H-isoindol-5-yl]-1-(diaminomethylidene)guanidine (PubChem CID 168604887) has the molecular formula C18H17BrN6O3 and a molecular weight of 445.28 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-3-oxo-1H-isoindol-5-yl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-3-oxo-1H-isoindol-5-yl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168604887 |
| Molecular Formula | C18H17BrN6O3 |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-3-oxo-1H-isoindol-5-yl]-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1cc(Br)c2c(c1)C(=O)N(Cc1ccc3c(c1)OCO3)C2 |
| InChI | InChI=1S/C18H17BrN6O3/c19-13-5-10(23-18(22)24-17(20)21)4-11-12(13)7-25(16(11)26)6-9-1-2-14-15(3-9)28-8-27-14/h1-5H,6-8H2,(H6,20,21,22,23,24) |
| InChIKey | JAALVJRRKWNCCO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 141.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|