C45H57N9O12 — CID 71745802
1,7,13-tris(3-aminopropyl)-4,10,16-tris(1,3-benzodioxol-5-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 71745802) has the molecular formula C45H57N9O12 and a molecular weight of 916.00 g/mol. Its IUPAC name is 1,7,13-tris(3-aminopropyl)-4,10,16-tris(1,3-benzodioxol-5-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | 1,7,13-tris(3-aminopropyl)-4,10,16-tris(1,3-benzodioxol-5-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 71745802 |
| Molecular Formula | C45H57N9O12 |
| Molecular Weight | 916.00 g/mol |
| Exact Mass | 915.41 |
| IUPAC Name | 1,7,13-tris(3-aminopropyl)-4,10,16-tris(1,3-benzodioxol-5-ylmethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | NCCCN1CC(=O)N(Cc2ccc3c(c2)OCO3)CC(=O)N(CCCN)CC(=O)N(Cc2ccc3c(c2)OCO3)CC(=O)N(CCCN)CC(=O)N(Cc2ccc3c(c2)OCO3)CC1=O |
| InChI | InChI=1S/C45H57N9O12/c46-10-1-13-49-22-43(58)53(20-32-5-8-35-38(17-32)65-29-62-35)26-41(56)51(15-3-12-48)24-45(60)54(21-33-6-9-36-39(18-33)66-30-63-36)27-42(57)50(14-2-11-47)23-44(59)52(25-40(49)55)19-31-4-7-34-37(16-31)64-28-61-34/h4-9,16-18H,1-3,10-15,19-30,46-48H2 |
| InChIKey | GJVWONPMBDKRHI-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 255.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.00 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |