C43H59N7O5 — CID 90445256
1,7-bis(3-aminopropyl)-4,10,13-tris[(3,5-dimethylphenyl)methyl]-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone (PubChem CID 90445256) has the molecular formula C43H59N7O5 and a molecular weight of 753.99 g/mol. Its IUPAC name is 1,7-bis(3-aminopropyl)-4,10,13-tris[(3,5-dimethylphenyl)methyl]-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone.
| Compound Name | 1,7-bis(3-aminopropyl)-4,10,13-tris[(3,5-dimethylphenyl)methyl]-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 90445256 |
| Molecular Formula | C43H59N7O5 |
| Molecular Weight | 753.99 g/mol |
| Exact Mass | 753.46 |
| IUPAC Name | 1,7-bis(3-aminopropyl)-4,10,13-tris[(3,5-dimethylphenyl)methyl]-1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone |
| SMILES | Cc1cc(C)cc(CN2CC(=O)N(CCCN)CC(=O)N(Cc3cc(C)cc(C)c3)CC(=O)N(Cc3cc(C)cc(C)c3)CC(=O)N(CCCN)CC2=O)c1 |
| InChI | InChI=1S/C43H59N7O5/c1-30-13-31(2)17-36(16-30)22-48-27-39(51)47(12-8-10-45)26-42(54)50(24-38-20-34(5)15-35(6)21-38)29-43(55)49(23-37-18-32(3)14-33(4)19-37)28-40(52)46(11-7-9-44)25-41(48)53/h13-21H,7-12,22-29,44-45H2,1-6H3 |
| InChIKey | VUACFYVHFIUNNP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 153.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.99 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |