C48H69N9O6 — CID 71745000
1,7,13-tris(3-aminopropyl)-4,10,16-tris[(3,5-dimethylphenyl)methyl]-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 71745000) has the molecular formula C48H69N9O6 and a molecular weight of 868.14 g/mol. Its IUPAC name is 1,7,13-tris(3-aminopropyl)-4,10,16-tris[(3,5-dimethylphenyl)methyl]-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | 1,7,13-tris(3-aminopropyl)-4,10,16-tris[(3,5-dimethylphenyl)methyl]-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 71745000 |
| Molecular Formula | C48H69N9O6 |
| Molecular Weight | 868.14 g/mol |
| Exact Mass | 867.54 |
| IUPAC Name | 1,7,13-tris(3-aminopropyl)-4,10,16-tris[(3,5-dimethylphenyl)methyl]-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | Cc1cc(C)cc(CN2CC(=O)N(CCCN)CC(=O)N(Cc3cc(C)cc(C)c3)CC(=O)N(CCCN)CC(=O)N(Cc3cc(C)cc(C)c3)CC(=O)N(CCCN)CC2=O)c1 |
| InChI | InChI=1S/C48H69N9O6/c1-34-16-35(2)20-40(19-34)25-55-31-43(58)53(14-8-11-50)29-47(62)57(27-42-23-38(5)18-39(6)24-42)33-45(60)54(15-9-12-51)30-48(63)56(26-41-21-36(3)17-37(4)22-41)32-44(59)52(13-7-10-49)28-46(55)61/h16-24H,7-15,25-33,49-51H2,1-6H3 |
| InChIKey | DFRHEORECJCVEQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 199.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 63 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |