C63H75N9O6 — CID 46866597
1,7,13-tris(3-aminopropyl)-4,10,16-tris(2,2-diphenylethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 46866597) has the molecular formula C63H75N9O6 and a molecular weight of 1054.35 g/mol. Its IUPAC name is 1,7,13-tris(3-aminopropyl)-4,10,16-tris(2,2-diphenylethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | 1,7,13-tris(3-aminopropyl)-4,10,16-tris(2,2-diphenylethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 46866597 |
| Molecular Formula | C63H75N9O6 |
| Molecular Weight | 1054.35 g/mol |
| Exact Mass | 1053.58 |
| IUPAC Name | 1,7,13-tris(3-aminopropyl)-4,10,16-tris(2,2-diphenylethyl)-1,4,7,10,13,16-hexazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | NCCCN1CC(=O)N(CC(c2ccccc2)c2ccccc2)CC(=O)N(CCCN)CC(=O)N(CC(c2ccccc2)c2ccccc2)CC(=O)N(CCCN)CC(=O)N(CC(c2ccccc2)c2ccccc2)CC1=O |
| InChI | InChI=1S/C63H75N9O6/c64-34-19-37-67-43-61(76)70(40-55(49-22-7-1-8-23-49)50-24-9-2-10-25-50)46-58(73)68(38-20-35-65)44-62(77)72(42-57(53-30-15-5-16-31-53)54-32-17-6-18-33-54)48-60(75)69(39-21-36-66)45-63(78)71(47-59(67)74)41-56(51-26-11-3-12-27-51)52-28-13-4-14-29-52/h1-18,22-33,55-57H,19-21,34-48,64-66H2 |
| InChIKey | DGRJPVHLEMVAOP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 199.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |