About [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate
[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate (PubChem CID 22443992) has the molecular formula C22H25N3O4
and a molecular weight of 395.46 g/mol. Its IUPAC name is [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate.
Molecular Properties
| Compound Name | [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate |
| PubChem CID | 22443992 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate |
| SMILES | NCCCN1CCN(OC(=O)CC(c2ccccc2)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C22H25N3O4/c23-12-7-13-24-14-15-25(22(28)21(24)27)29-20(26)16-19(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-11,19H,7,12-16,23H2 |
| InChIKey | SVXHVAKAKGIUAV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate?
The IUPAC name of [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate (CID 22443992) is [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate.
What is the SMILES notation for [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate?
The canonical SMILES for [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate is NCCCN1CCN(OC(=O)CC(c2ccccc2)c2ccccc2)C(=O)C1=O.
What is the InChIKey of [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate?
The InChIKey is SVXHVAKAKGIUAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O4/c23-12-7-13-24-14-15-25(22(28)21(24)27)29-20(26)16-19(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-11,19H,7,12-16,23H2.
What are the key properties of [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate?
[4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate has a molecular weight of 395.46 g/mol, XLogP of 1.69, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-aminopropyl)-2,3-dioxopiperazin-1-yl] 3,3-diphenylpropanoate is sourced from PubChem (CID 22443992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).