C24H33N2O2+ — CID 24842416
2-(4-ethyl-4-methylpiperazin-4-ium-1-yl)ethyl 3,3-diphenylpropanoate (PubChem CID 24842416) has the molecular formula C24H33N2O2+ and a molecular weight of 381.54 g/mol. Its IUPAC name is 2-(4-ethyl-4-methylpiperazin-4-ium-1-yl)ethyl 3,3-diphenylpropanoate.
| Compound Name | 2-(4-ethyl-4-methylpiperazin-4-ium-1-yl)ethyl 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 24842416 |
| Molecular Formula | C24H33N2O2+ |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 2-(4-ethyl-4-methylpiperazin-4-ium-1-yl)ethyl 3,3-diphenylpropanoate |
| SMILES | CC[N+]1(C)CCN(CCOC(=O)CC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H33N2O2/c1-3-26(2)17-14-25(15-18-26)16-19-28-24(27)20-23(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-13,23H,3,14-20H2,1-2H3/q+1 |
| InChIKey | CZMYQUKIEUBEQT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|