C24H33IN2O — CID 3030264
1-(4-butyl-4-methylpiperazin-4-ium-1-yl)-3,3-diphenylpropan-1-one iodide (PubChem CID 3030264) has the molecular formula C24H33IN2O and a molecular weight of 492.45 g/mol. Its IUPAC name is 1-(4-butyl-4-methylpiperazin-4-ium-1-yl)-3,3-diphenylpropan-1-one iodide.
| Compound Name | 1-(4-butyl-4-methylpiperazin-4-ium-1-yl)-3,3-diphenylpropan-1-one iodide |
|---|---|
| PubChem CID | 3030264 |
| Molecular Formula | C24H33IN2O |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 1-(4-butyl-4-methylpiperazin-4-ium-1-yl)-3,3-diphenylpropan-1-one iodide |
| SMILES | CCCC[N+]1(C)CCN(C(=O)CC(c2ccccc2)c2ccccc2)CC1.[I-] |
| InChI | InChI=1S/C24H33N2O.HI/c1-3-4-17-26(2)18-15-25(16-19-26)24(27)20-23(21-11-7-5-8-12-21)22-13-9-6-10-14-22;/h5-14,23H,3-4,15-20H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | JLZFGCMQEYQMCJ-UHFFFAOYSA-M |
| XLogP | 1.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|