C28H33N4O2+ — CID 10077007
1-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-4-(pyridin-2-ylmethyl)piperazin-4-ium-1-yl]-3,3-diphenylpropan-1-one (PubChem CID 10077007) has the molecular formula C28H33N4O2+ and a molecular weight of 457.60 g/mol. Its IUPAC name is 1-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-4-(pyridin-2-ylmethyl)piperazin-4-ium-1-yl]-3,3-diphenylpropan-1-one.
| Compound Name | 1-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-4-(pyridin-2-ylmethyl)piperazin-4-ium-1-yl]-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 10077007 |
| Molecular Formula | C28H33N4O2+ |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 1-[4-[(E)-N-methoxy-C-methylcarbonimidoyl]-4-(pyridin-2-ylmethyl)piperazin-4-ium-1-yl]-3,3-diphenylpropan-1-one |
| SMILES | CO/N=C(\C)[N+]1(Cc2ccccn2)CCN(C(=O)CC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H33N4O2/c1-23(30-34-2)32(22-26-15-9-10-16-29-26)19-17-31(18-20-32)28(33)21-27(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-16,27H,17-22H2,1-2H3/q+1/b30-23+ |
| InChIKey | NZVSVQNHZMRRDS-JJKYIXSRSA-N |
| XLogP | 4.44 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|