C29H34N4O2 — CID 10457442
1-[4-[(3E)-3-methoxyimino-1-pyridin-2-ylbutan-2-yl]piperazin-1-yl]-3,3-diphenylpropan-1-one (PubChem CID 10457442) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 1-[4-[(3E)-3-methoxyimino-1-pyridin-2-ylbutan-2-yl]piperazin-1-yl]-3,3-diphenylpropan-1-one.
| Compound Name | 1-[4-[(3E)-3-methoxyimino-1-pyridin-2-ylbutan-2-yl]piperazin-1-yl]-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 10457442 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 1-[4-[(3E)-3-methoxyimino-1-pyridin-2-ylbutan-2-yl]piperazin-1-yl]-3,3-diphenylpropan-1-one |
| SMILES | CO/N=C(\C)C(Cc1ccccn1)N1CCN(C(=O)CC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H34N4O2/c1-23(31-35-2)28(21-26-15-9-10-16-30-26)32-17-19-33(20-18-32)29(34)22-27(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-16,27-28H,17-22H2,1-2H3/b31-23+ |
| InChIKey | DCQQTKRXPNXNSR-UQRQXUALSA-N |
| XLogP | 4.38 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|