C21H26N2O — CID 119563055
1-[4-(methylamino)piperidin-1-yl]-3,3-diphenylpropan-1-one (PubChem CID 119563055) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[4-(methylamino)piperidin-1-yl]-3,3-diphenylpropan-1-one.
| Compound Name | 1-[4-(methylamino)piperidin-1-yl]-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 119563055 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-[4-(methylamino)piperidin-1-yl]-3,3-diphenylpropan-1-one |
| SMILES | CNC1CCN(C(=O)CC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N2O/c1-22-19-12-14-23(15-13-19)21(24)16-20(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-11,19-20,22H,12-16H2,1H3 |
| InChIKey | JJEKXYSFIFTPBK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |