C22H28N2O3S — CID 72877580
N-[1-[3-(2-methylphenyl)-3-phenylpropanoyl]piperidin-4-yl]methanesulfonamide (PubChem CID 72877580) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N-[1-[3-(2-methylphenyl)-3-phenylpropanoyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[3-(2-methylphenyl)-3-phenylpropanoyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 72877580 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[1-[3-(2-methylphenyl)-3-phenylpropanoyl]piperidin-4-yl]methanesulfonamide |
| SMILES | Cc1ccccc1C(CC(=O)N1CCC(NS(C)(=O)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O3S/c1-17-8-6-7-11-20(17)21(18-9-4-3-5-10-18)16-22(25)24-14-12-19(13-15-24)23-28(2,26)27/h3-11,19,21,23H,12-16H2,1-2H3 |
| InChIKey | HXVNHEODFVRPTP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |