C15H22N2O4S — CID 94872067
N-[1-[(2R)-2-methoxy-2-phenylacetyl]piperidin-4-yl]methanesulfonamide (PubChem CID 94872067) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-[1-[(2R)-2-methoxy-2-phenylacetyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[(2R)-2-methoxy-2-phenylacetyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 94872067 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-[1-[(2R)-2-methoxy-2-phenylacetyl]piperidin-4-yl]methanesulfonamide |
| SMILES | CO[C@@H](C(=O)N1CCC(NS(C)(=O)=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C15H22N2O4S/c1-21-14(12-6-4-3-5-7-12)15(18)17-10-8-13(9-11-17)16-22(2,19)20/h3-7,13-14,16H,8-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | WHMAWMUUJKLQMR-CQSZACIVSA-N |
| XLogP | 0.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |