C23H30N2O — CID 20795205
1-(4-butylpiperazin-1-yl)-3,3-diphenylpropan-1-one (PubChem CID 20795205) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 1-(4-butylpiperazin-1-yl)-3,3-diphenylpropan-1-one.
| Compound Name | 1-(4-butylpiperazin-1-yl)-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 20795205 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 1-(4-butylpiperazin-1-yl)-3,3-diphenylpropan-1-one |
| SMILES | CCCCN1CCN(C(=O)CC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O/c1-2-3-14-24-15-17-25(18-16-24)23(26)19-22(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,22H,2-3,14-19H2,1H3 |
| InChIKey | GZCSZUJWSLQBLQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |