C29H32N2O2 — CID 142151557
1-[4-[(Z)-3-hydroxy-4-phenylbut-3-enyl]piperazin-1-yl]-3,3-diphenylpropan-1-one (PubChem CID 142151557) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 1-[4-[(Z)-3-hydroxy-4-phenylbut-3-enyl]piperazin-1-yl]-3,3-diphenylpropan-1-one.
| Compound Name | 1-[4-[(Z)-3-hydroxy-4-phenylbut-3-enyl]piperazin-1-yl]-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 142151557 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 1-[4-[(Z)-3-hydroxy-4-phenylbut-3-enyl]piperazin-1-yl]-3,3-diphenylpropan-1-one |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)N1CCN(CC/C(O)=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C29H32N2O2/c32-27(22-24-10-4-1-5-11-24)16-17-30-18-20-31(21-19-30)29(33)23-28(25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,22,28,32H,16-21,23H2/b27-22- |
| InChIKey | URUVULBSFJANIB-QYQHSDTDSA-N |
| XLogP | 5.34 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|