C24H30N2O3 — CID 13488733
2-[4-(2,2-diphenylethyl)piperazin-1-yl]ethyl 3-oxobutanoate (PubChem CID 13488733) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[4-(2,2-diphenylethyl)piperazin-1-yl]ethyl 3-oxobutanoate.
| Compound Name | 2-[4-(2,2-diphenylethyl)piperazin-1-yl]ethyl 3-oxobutanoate |
|---|---|
| PubChem CID | 13488733 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-[4-(2,2-diphenylethyl)piperazin-1-yl]ethyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCCN1CCN(CC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N2O3/c1-20(27)18-24(28)29-17-16-25-12-14-26(15-13-25)19-23(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-11,23H,12-19H2,1H3 |
| InChIKey | QGTHEFFBTFSATM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|