C23H28N2O3 — CID 54180218
2-(1-benzhydrylpiperazin-2-yl)ethyl 3-oxobutanoate (PubChem CID 54180218) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-(1-benzhydrylpiperazin-2-yl)ethyl 3-oxobutanoate.
| Compound Name | 2-(1-benzhydrylpiperazin-2-yl)ethyl 3-oxobutanoate |
|---|---|
| PubChem CID | 54180218 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-(1-benzhydrylpiperazin-2-yl)ethyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCCC1CNCCN1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O3/c1-18(26)16-22(27)28-15-12-21-17-24-13-14-25(21)23(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,21,23-24H,12-17H2,1H3 |
| InChIKey | PBGQFMPLWBQNQW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|