C37H37N3O5 — CID 88523555
5-O-[2-(1-benzhydrylpiperazin-2-yl)ethyl] 3-O-methyl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 88523555) has the molecular formula C37H37N3O5 and a molecular weight of 603.72 g/mol. Its IUPAC name is 5-O-[2-(1-benzhydrylpiperazin-2-yl)ethyl] 3-O-methyl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-(1-benzhydrylpiperazin-2-yl)ethyl] 3-O-methyl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 88523555 |
| Molecular Formula | C37H37N3O5 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | 5-O-[2-(1-benzhydrylpiperazin-2-yl)ethyl] 3-O-methyl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C#Cc1cccc(C2C(C(=O)OCCC3CNCCN3C(c3ccccc3)c3ccccc3)=C(C)NC(C=O)=C2C(=O)OC)c1 |
| InChI | InChI=1S/C37H37N3O5/c1-4-26-12-11-17-29(22-26)33-32(25(2)39-31(24-41)34(33)36(42)44-3)37(43)45-21-18-30-23-38-19-20-40(30)35(27-13-7-5-8-14-27)28-15-9-6-10-16-28/h1,5-17,22,24,30,33,35,38-39H,18-21,23H2,2-3H3 |
| InChIKey | HJJPXQQAGUROBL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|