C21H28Cl2N2O2 — CID 178079830
ethyl 2-[(2R)-1-benzhydrylpiperazin-2-yl]acetate;dihydrochloride (PubChem CID 178079830) has the molecular formula C21H28Cl2N2O2 and a molecular weight of 411.37 g/mol. Its IUPAC name is ethyl 2-[(2R)-1-benzhydrylpiperazin-2-yl]acetate;dihydrochloride.
| Compound Name | ethyl 2-[(2R)-1-benzhydrylpiperazin-2-yl]acetate;dihydrochloride |
|---|---|
| PubChem CID | 178079830 |
| Molecular Formula | C21H28Cl2N2O2 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | ethyl 2-[(2R)-1-benzhydrylpiperazin-2-yl]acetate;dihydrochloride |
| SMILES | CCOC(=O)C[C@@H]1CNCCN1C(c1ccccc1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C21H26N2O2.2ClH/c1-2-25-20(24)15-19-16-22-13-14-23(19)21(17-9-5-3-6-10-17)18-11-7-4-8-12-18;;/h3-12,19,21-22H,2,13-16H2,1H3;2*1H/t19-;;/m1../s1 |
| InChIKey | ZRVKOZKJCISOAJ-JQDLGSOUSA-N |
| XLogP | 3.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |