C25H32N2O4 — CID 70522769
2-(2-methylazetidin-2-yl)acetic acid;methyl 2-(1-benzhydrylazetidin-2-yl)acetate (PubChem CID 70522769) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-(2-methylazetidin-2-yl)acetic acid;methyl 2-(1-benzhydrylazetidin-2-yl)acetate.
| Compound Name | 2-(2-methylazetidin-2-yl)acetic acid;methyl 2-(1-benzhydrylazetidin-2-yl)acetate |
|---|---|
| PubChem CID | 70522769 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 2-(2-methylazetidin-2-yl)acetic acid;methyl 2-(1-benzhydrylazetidin-2-yl)acetate |
| SMILES | CC1(CC(=O)O)CCN1.COC(=O)CC1CCN1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO2.C6H11NO2/c1-22-18(21)14-17-12-13-20(17)19(15-8-4-2-5-9-15)16-10-6-3-7-11-16;1-6(2-3-7-6)4-5(8)9/h2-11,17,19H,12-14H2,1H3;7H,2-4H2,1H3,(H,8,9) |
| InChIKey | HJBXPJOGGQOKEA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |