C24H27NO4S — CID 18968776
(1-benzhydrylazetidin-2-yl)methanol;4-methylbenzenesulfonic acid (PubChem CID 18968776) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is (1-benzhydrylazetidin-2-yl)methanol;4-methylbenzenesulfonic acid.
| Compound Name | (1-benzhydrylazetidin-2-yl)methanol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 18968776 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (1-benzhydrylazetidin-2-yl)methanol;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.OCC1CCN1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO.C7H8O3S/c19-13-16-11-12-18(16)17(14-7-3-1-4-8-14)15-9-5-2-6-10-15;1-6-2-4-7(5-3-6)11(8,9)10/h1-10,16-17,19H,11-13H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | KDENQUJGWAADKG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|