C17H23NO4S — CID 129104588
4-methylbenzenesulfonic acid;N-(2-methyl-1-phenylpropyl)hydroxylamine (PubChem CID 129104588) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;N-(2-methyl-1-phenylpropyl)hydroxylamine.
| Compound Name | 4-methylbenzenesulfonic acid;N-(2-methyl-1-phenylpropyl)hydroxylamine |
|---|---|
| PubChem CID | 129104588 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 4-methylbenzenesulfonic acid;N-(2-methyl-1-phenylpropyl)hydroxylamine |
| SMILES | CC(C)C(NO)c1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H15NO.C7H8O3S/c1-8(2)10(11-12)9-6-4-3-5-7-9;1-6-2-4-7(5-3-6)11(8,9)10/h3-8,10-12H,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | KSCYHCZJXYLSEX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|