C20H26O6S2 — CID 162323448
cyclohexyl(phenyl)methanesulfonic acid;4-methylbenzenesulfonic acid (PubChem CID 162323448) has the molecular formula C20H26O6S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is cyclohexyl(phenyl)methanesulfonic acid;4-methylbenzenesulfonic acid.
| Compound Name | cyclohexyl(phenyl)methanesulfonic acid;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 162323448 |
| Molecular Formula | C20H26O6S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | cyclohexyl(phenyl)methanesulfonic acid;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=S(=O)(O)C(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C13H18O3S.C7H8O3S/c14-17(15,16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-6-2-4-7(5-3-6)11(8,9)10/h1,3-4,7-8,12-13H,2,5-6,9-10H2,(H,14,15,16);2-5H,1H3,(H,8,9,10) |
| InChIKey | QVMBLVQOFKSSAN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|