C21H21NO5 — CID 19813398
diethyl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 19813398) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is diethyl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 19813398 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | diethyl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C#Cc1cccc(C2C(C(=O)OCC)=C(C)NC(C=O)=C2C(=O)OCC)c1 |
| InChI | InChI=1S/C21H21NO5/c1-5-14-9-8-10-15(11-14)18-17(20(24)26-6-2)13(4)22-16(12-23)19(18)21(25)27-7-3/h1,8-12,18,22H,6-7H2,2-4H3 |
| InChIKey | NVCVEVOESWUQRV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|