C39H41N3O5 — CID 88523499
5-O-[1-(4-benzhydrylpiperazin-1-yl)ethyl] 3-O-propan-2-yl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 88523499) has the molecular formula C39H41N3O5 and a molecular weight of 631.77 g/mol. Its IUPAC name is 5-O-[1-(4-benzhydrylpiperazin-1-yl)ethyl] 3-O-propan-2-yl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[1-(4-benzhydrylpiperazin-1-yl)ethyl] 3-O-propan-2-yl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 88523499 |
| Molecular Formula | C39H41N3O5 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | 5-O-[1-(4-benzhydrylpiperazin-1-yl)ethyl] 3-O-propan-2-yl 4-(3-ethynylphenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | C#Cc1cccc(C2C(C(=O)OC(C)N3CCN(C(c4ccccc4)c4ccccc4)CC3)=C(C)NC(C=O)=C2C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C39H41N3O5/c1-6-29-14-13-19-32(24-29)35-34(27(4)40-33(25-43)36(35)39(45)46-26(2)3)38(44)47-28(5)41-20-22-42(23-21-41)37(30-15-9-7-10-16-30)31-17-11-8-12-18-31/h1,7-19,24-26,28,35,37,40H,20-23H2,2-5H3 |
| InChIKey | LQTRCMKAXQHIEL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|