C19H21NO6 — CID 13469468
diethyl 2-formyl-4-(3-hydroxyphenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 13469468) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is diethyl 2-formyl-4-(3-hydroxyphenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-formyl-4-(3-hydroxyphenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 13469468 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | diethyl 2-formyl-4-(3-hydroxyphenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C=O)=C(C(=O)OCC)C1c1cccc(O)c1 |
| InChI | InChI=1S/C19H21NO6/c1-4-25-18(23)15-11(3)20-14(10-21)17(19(24)26-5-2)16(15)12-7-6-8-13(22)9-12/h6-10,16,20,22H,4-5H2,1-3H3 |
| InChIKey | VKUBKOFPGZFZIQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|