C26H26N2O7 — CID 67918910
diethyl 2-[2-(4-hydroxyphenyl)ethenyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67918910) has the molecular formula C26H26N2O7 and a molecular weight of 478.50 g/mol. Its IUPAC name is diethyl 2-[2-(4-hydroxyphenyl)ethenyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-[2-(4-hydroxyphenyl)ethenyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67918910 |
| Molecular Formula | C26H26N2O7 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | diethyl 2-[2-(4-hydroxyphenyl)ethenyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C=Cc2ccc(O)cc2)=C(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H26N2O7/c1-4-34-25(30)22-16(3)27-21(14-11-17-9-12-20(29)13-10-17)24(26(31)35-5-2)23(22)18-7-6-8-19(15-18)28(32)33/h6-15,23,27,29H,4-5H2,1-3H3 |
| InChIKey | CJWDOWLFKNQYBE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|