C27H28N2O8 — CID 67918858
diethyl 2-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67918858) has the molecular formula C27H28N2O8 and a molecular weight of 508.53 g/mol. Its IUPAC name is diethyl 2-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67918858 |
| Molecular Formula | C27H28N2O8 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | diethyl 2-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C=Cc2ccc(O)c(OC)c2)=C(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H28N2O8/c1-5-36-26(31)23-16(3)28-20(12-10-17-11-13-21(30)22(14-17)35-4)25(27(32)37-6-2)24(23)18-8-7-9-19(15-18)29(33)34/h7-15,24,28,30H,5-6H2,1-4H3 |
| InChIKey | HULBESZZVFDYHE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|