C21H24FNO6 — CID 70590356
diethyl 2-(acetyloxymethyl)-4-(3-fluorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70590356) has the molecular formula C21H24FNO6 and a molecular weight of 405.42 g/mol. Its IUPAC name is diethyl 2-(acetyloxymethyl)-4-(3-fluorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-(acetyloxymethyl)-4-(3-fluorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70590356 |
| Molecular Formula | C21H24FNO6 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | diethyl 2-(acetyloxymethyl)-4-(3-fluorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(COC(C)=O)=C(C(=O)OCC)C1c1cccc(F)c1 |
| InChI | InChI=1S/C21H24FNO6/c1-5-27-20(25)17-12(3)23-16(11-29-13(4)24)19(21(26)28-6-2)18(17)14-8-7-9-15(22)10-14/h7-10,18,23H,5-6,11H2,1-4H3 |
| InChIKey | CXEZIQKIELKFLN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|