C22H31N3O3S — CID 70711996
2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-methyl-2-phenyl-N-(thian-4-yl)acetamide (PubChem CID 70711996) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is 2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-methyl-2-phenyl-N-(thian-4-yl)acetamide.
| Compound Name | 2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-methyl-2-phenyl-N-(thian-4-yl)acetamide |
|---|---|
| PubChem CID | 70711996 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-methyl-2-phenyl-N-(thian-4-yl)acetamide |
| SMILES | CCCCN1CCN(C(C(=O)N(C)C2CCSCC2)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C22H31N3O3S/c1-3-4-12-24-13-14-25(22(28)21(24)27)19(17-8-6-5-7-9-17)20(26)23(2)18-10-15-29-16-11-18/h5-9,18-19H,3-4,10-16H2,1-2H3 |
| InChIKey | HRXCOWZTBYBTBG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|